C8H10O4 — CID 102096343
(3R,3aR,5R,7aS)-3,5-dihydroxy-3a,4,5,7a-tetrahydro-3H-2-benzofuran-1-one (PubChem CID 102096343) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is (3R,3aR,5R,7aS)-3,5-dihydroxy-3a,4,5,7a-tetrahydro-3H-2-benzofuran-1-one.
| Compound Name | (3R,3aR,5R,7aS)-3,5-dihydroxy-3a,4,5,7a-tetrahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 102096343 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | (3R,3aR,5R,7aS)-3,5-dihydroxy-3a,4,5,7a-tetrahydro-3H-2-benzofuran-1-one |
| SMILES | O=C1O[C@@H](O)[C@@H]2C[C@@H](O)C=C[C@H]12 |
| InChI | InChI=1S/C8H10O4/c9-4-1-2-5-6(3-4)8(11)12-7(5)10/h1-2,4-6,8-9,11H,3H2/t4-,5-,6+,8+/m0/s1 |
| InChIKey | KQCYSRNMKUNPHP-LZCNBPATSA-N |
| XLogP | -0.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|