C9H10N2OS — CID 7859195
(4aS,8aS)-3-methyl-2-sulfanylidene-4a,8a-dihydro-1H-quinazolin-4-one (PubChem CID 7859195) has the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. Its IUPAC name is (4aS,8aS)-3-methyl-2-sulfanylidene-4a,8a-dihydro-1H-quinazolin-4-one.
| Compound Name | (4aS,8aS)-3-methyl-2-sulfanylidene-4a,8a-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 7859195 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | (4aS,8aS)-3-methyl-2-sulfanylidene-4a,8a-dihydro-1H-quinazolin-4-one |
| SMILES | CN1C(=O)[C@H]2C=CC=C[C@@H]2NC1=S |
| InChI | InChI=1S/C9H10N2OS/c1-11-8(12)6-4-2-3-5-7(6)10-9(11)13/h2-7H,1H3,(H,10,13)/t6-,7-/m0/s1 |
| InChIKey | FNEBJEYOGPWINP-BQBZGAKWSA-N |
| XLogP | 0.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|