C6H10N2O2S — CID 932985
(5R)-5-[(1S)-1-hydroxyethyl]-3-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 932985) has the molecular formula C6H10N2O2S and a molecular weight of 174.22 g/mol. Its IUPAC name is (5R)-5-[(1S)-1-hydroxyethyl]-3-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5R)-5-[(1S)-1-hydroxyethyl]-3-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 932985 |
| Molecular Formula | C6H10N2O2S |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | (5R)-5-[(1S)-1-hydroxyethyl]-3-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | C[C@H](O)[C@H]1NC(=S)N(C)C1=O |
| InChI | InChI=1S/C6H10N2O2S/c1-3(9)4-5(10)8(2)6(11)7-4/h3-4,9H,1-2H3,(H,7,11)/t3-,4+/m0/s1 |
| InChIKey | NPKGNZLCSOITLN-IUYQGCFVSA-N |
| XLogP | -0.92 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|