C5H6N2O3S — CID 42586318
(4R)-1-methyl-5-oxo-2-sulfanylideneimidazolidine-4-carboxylic acid (PubChem CID 42586318) has the molecular formula C5H6N2O3S and a molecular weight of 174.18 g/mol. Its IUPAC name is (4R)-1-methyl-5-oxo-2-sulfanylideneimidazolidine-4-carboxylic acid.
| Compound Name | (4R)-1-methyl-5-oxo-2-sulfanylideneimidazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 42586318 |
| Molecular Formula | C5H6N2O3S |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.01 |
| IUPAC Name | (4R)-1-methyl-5-oxo-2-sulfanylideneimidazolidine-4-carboxylic acid |
| SMILES | CN1C(=O)[C@H](C(=O)O)NC1=S |
| InChI | InChI=1S/C5H6N2O3S/c1-7-3(8)2(4(9)10)6-5(7)11/h2H,1H3,(H,6,11)(H,9,10)/t2-/m1/s1 |
| InChIKey | YLGDQVFELLTYQW-UWTATZPHSA-N |
| XLogP | -1.21 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|