C15H17N3O2 — CID 20647023
10,13-dimethyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),3,5-triene-12,14-dione (PubChem CID 20647023) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 10,13-dimethyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),3,5-triene-12,14-dione.
| Compound Name | 10,13-dimethyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),3,5-triene-12,14-dione |
|---|---|
| PubChem CID | 20647023 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 10,13-dimethyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),3,5-triene-12,14-dione |
| SMILES | CC1C2=C(CC3C(=O)N(C)C(=O)N13)C1C=CC=CC1N2 |
| InChI | InChI=1S/C15H17N3O2/c1-8-13-10(9-5-3-4-6-11(9)16-13)7-12-14(19)17(2)15(20)18(8)12/h3-6,8-9,11-12,16H,7H2,1-2H3 |
| InChIKey | OSXWNNPSXWAZSD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|