C8H7NO2 — CID 175749281
7a-deuterio-3aH-isoindole-1,3-dione (PubChem CID 175749281) has the molecular formula C8H7NO2 and a molecular weight of 150.16 g/mol. Its IUPAC name is 7a-deuterio-3aH-isoindole-1,3-dione.
| Compound Name | 7a-deuterio-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 175749281 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 150.16 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 7a-deuterio-3aH-isoindole-1,3-dione |
| SMILES | [2H]C12C=CC=CC1C(=O)NC2=O |
| InChI | InChI=1S/C8H7NO2/c10-7-5-3-1-2-4-6(5)8(11)9-7/h1-6H,(H,9,10,11)/i5D |
| InChIKey | RDHHZPRHIKNBBI-UICOGKGYSA-N |
| XLogP | 0.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.16 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|