C8H7NO2S2 — CID 163216242
7a-(disulfanyl)-3aH-isoindole-1,3-dione (PubChem CID 163216242) has the molecular formula C8H7NO2S2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 7a-(disulfanyl)-3aH-isoindole-1,3-dione.
| Compound Name | 7a-(disulfanyl)-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 163216242 |
| Molecular Formula | C8H7NO2S2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 212.99 |
| IUPAC Name | 7a-(disulfanyl)-3aH-isoindole-1,3-dione |
| SMILES | O=C1NC(=O)C2(SS)C=CC=CC12 |
| InChI | InChI=1S/C8H7NO2S2/c10-6-5-3-1-2-4-8(5,13-12)7(11)9-6/h1-5,12H,(H,9,10,11) |
| InChIKey | BFASLWUNWKPHCT-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|