C10H15NO — CID 90861348
2,3,3a,7a-tetrahydroisoindol-1-one;ethane (PubChem CID 90861348) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 2,3,3a,7a-tetrahydroisoindol-1-one;ethane.
| Compound Name | 2,3,3a,7a-tetrahydroisoindol-1-one;ethane |
|---|---|
| PubChem CID | 90861348 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 2,3,3a,7a-tetrahydroisoindol-1-one;ethane |
| SMILES | CC.O=C1NCC2C=CC=CC12 |
| InChI | InChI=1S/C8H9NO.C2H6/c10-8-7-4-2-1-3-6(7)5-9-8;1-2/h1-4,6-7H,5H2,(H,9,10);1-2H3 |
| InChIKey | MHKJBTBUWDYOBO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |