C17H29NO — CID 142181179
10-azatricyclo[6.3.1.02,7]dodeca-2,4,6-trien-9-one;ethane (PubChem CID 142181179) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is 10-azatricyclo[6.3.1.02,7]dodeca-2,4,6-trien-9-one;ethane.
| Compound Name | 10-azatricyclo[6.3.1.02,7]dodeca-2,4,6-trien-9-one;ethane |
|---|---|
| PubChem CID | 142181179 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 10-azatricyclo[6.3.1.02,7]dodeca-2,4,6-trien-9-one;ethane |
| SMILES | CC.CC.CC.O=C1NCC2CC1c1ccccc12 |
| InChI | InChI=1S/C11H11NO.3C2H6/c13-11-10-5-7(6-12-11)8-3-1-2-4-9(8)10;3*1-2/h1-4,7,10H,5-6H2,(H,12,13);3*1-2H3 |
| InChIKey | VOGGCIGQDRNCDT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |