C6H6O2 — CID 123720503
3a,6a-dihydrofuro[2,3-b]furan (PubChem CID 123720503) has the molecular formula C6H6O2 and a molecular weight of 110.11 g/mol. Its IUPAC name is 3a,6a-dihydrofuro[2,3-b]furan.
| Compound Name | 3a,6a-dihydrofuro[2,3-b]furan |
|---|---|
| PubChem CID | 123720503 |
| Molecular Formula | C6H6O2 |
| Molecular Weight | 110.11 g/mol |
| Exact Mass | 110.04 |
| IUPAC Name | 3a,6a-dihydrofuro[2,3-b]furan |
| SMILES | C1=CC2C=COC2O1 |
| InChI | InChI=1S/C6H6O2/c1-3-7-6-5(1)2-4-8-6/h1-6H |
| InChIKey | DPOVUVVTWRRYAY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.11 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |