C4H4N2O3 — CID 141306716
6-hydroxy-1,6-dihydropyrimidine-2,5-dione (PubChem CID 141306716) has the molecular formula C4H4N2O3 and a molecular weight of 128.09 g/mol. Its IUPAC name is 6-hydroxy-1,6-dihydropyrimidine-2,5-dione.
| Compound Name | 6-hydroxy-1,6-dihydropyrimidine-2,5-dione |
|---|---|
| PubChem CID | 141306716 |
| Molecular Formula | C4H4N2O3 |
| Molecular Weight | 128.09 g/mol |
| Exact Mass | 128.02 |
| IUPAC Name | 6-hydroxy-1,6-dihydropyrimidine-2,5-dione |
| SMILES | O=C1N=CC(=O)C(O)N1 |
| InChI | InChI=1S/C4H4N2O3/c7-2-1-5-4(9)6-3(2)8/h1,3,8H,(H,6,9) |
| InChIKey | IIUOZBRTCKVVNZ-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.09 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |