C15H20N2OS — CID 7276310
(1S,6S,7R)-1-methyl-N-[(Z)-1-thiophen-2-ylethylideneamino]bicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 7276310) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is (1S,6S,7R)-1-methyl-N-[(Z)-1-thiophen-2-ylethylideneamino]bicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | (1S,6S,7R)-1-methyl-N-[(Z)-1-thiophen-2-ylethylideneamino]bicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 7276310 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (1S,6S,7R)-1-methyl-N-[(Z)-1-thiophen-2-ylethylideneamino]bicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | C/C(=N/NC(=O)[C@@H]1[C@@H]2CCCC[C@]12C)c1cccs1 |
| InChI | InChI=1S/C15H20N2OS/c1-10(12-7-5-9-19-12)16-17-14(18)13-11-6-3-4-8-15(11,13)2/h5,7,9,11,13H,3-4,6,8H2,1-2H3,(H,17,18)/b16-10-/t11-,13-,15-/m0/s1 |
| InChIKey | VZCUVFYTBJAADC-FANIIUDCSA-N |
| XLogP | 3.41 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|