C22H32N2O3 — CID 7276312
(1S,6S,7R)-N-[(Z)-[2,4-di(propan-2-yloxy)phenyl]methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 7276312) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is (1S,6S,7R)-N-[(Z)-[2,4-di(propan-2-yloxy)phenyl]methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | (1S,6S,7R)-N-[(Z)-[2,4-di(propan-2-yloxy)phenyl]methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 7276312 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | (1S,6S,7R)-N-[(Z)-[2,4-di(propan-2-yloxy)phenyl]methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | CC(C)Oc1ccc(/C=N\NC(=O)[C@@H]2[C@@H]3CCCC[C@]23C)c(OC(C)C)c1 |
| InChI | InChI=1S/C22H32N2O3/c1-14(2)26-17-10-9-16(19(12-17)27-15(3)4)13-23-24-21(25)20-18-8-6-7-11-22(18,20)5/h9-10,12-15,18,20H,6-8,11H2,1-5H3,(H,24,25)/b23-13-/t18-,20-,22-/m0/s1 |
| InChIKey | OCNMBOYXZHIZMX-ZQWCWUKFSA-N |
| XLogP | 4.54 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|