C30H33NO6 — CID 72768617
N-[2-formyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide (PubChem CID 72768617) has the molecular formula C30H33NO6 and a molecular weight of 503.60 g/mol. Its IUPAC name is N-[2-formyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[2-formyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 72768617 |
| Molecular Formula | C30H33NO6 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | N-[2-formyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)NC1C(C=O)OC(COCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C30H33NO6/c1-22(33)31-28-26(17-32)37-27(21-34-18-23-11-5-2-6-12-23)29(35-19-24-13-7-3-8-14-24)30(28)36-20-25-15-9-4-10-16-25/h2-17,26-30H,18-21H2,1H3,(H,31,33) |
| InChIKey | PINLKVSXDWNCOC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|