C14H8F3NO — CID 72771061
2-phenyl-5-(trifluoromethyl)furo[3,2-b]pyridine (PubChem CID 72771061) has the molecular formula C14H8F3NO and a molecular weight of 263.22 g/mol. Its IUPAC name is 2-phenyl-5-(trifluoromethyl)furo[3,2-b]pyridine.
| Compound Name | 2-phenyl-5-(trifluoromethyl)furo[3,2-b]pyridine |
|---|---|
| PubChem CID | 72771061 |
| Molecular Formula | C14H8F3NO |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2-phenyl-5-(trifluoromethyl)furo[3,2-b]pyridine |
| SMILES | FC(F)(F)c1ccc2oc(-c3ccccc3)cc2n1 |
| InChI | InChI=1S/C14H8F3NO/c15-14(16,17)13-7-6-11-10(18-13)8-12(19-11)9-4-2-1-3-5-9/h1-8H |
| InChIKey | NEAUIENOHKIPRZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |