C19H24N2O3 — CID 7277195
3-[2-(2,5-diethylphenyl)-2-oxoethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 7277195) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 3-[2-(2,5-diethylphenyl)-2-oxoethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[2-(2,5-diethylphenyl)-2-oxoethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 7277195 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 3-[2-(2,5-diethylphenyl)-2-oxoethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | CCc1ccc(CC)c(C(=O)CN2C(=O)NC3(CCCC3)C2=O)c1 |
| InChI | InChI=1S/C19H24N2O3/c1-3-13-7-8-14(4-2)15(11-13)16(22)12-21-17(23)19(20-18(21)24)9-5-6-10-19/h7-8,11H,3-6,9-10,12H2,1-2H3,(H,20,24) |
| InChIKey | QCAZIHZQKMXELW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|