C20H30N2O5 — CID 7278741
4-O-[2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-O-ethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate (PubChem CID 7278741) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is 4-O-[2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-O-ethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | 4-O-[2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-O-ethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 7278741 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 4-O-[2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-O-ethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(C(=O)OCC(=O)N[C@@H]2CCC[C@@H](C)[C@H]2C)c1C |
| InChI | InChI=1S/C20H30N2O5/c1-6-26-20(25)18-13(4)17(14(5)21-18)19(24)27-10-16(23)22-15-9-7-8-11(2)12(15)3/h11-12,15,21H,6-10H2,1-5H3,(H,22,23)/t11-,12-,15-/m1/s1 |
| InChIKey | ZBBFEEGWMPCPSF-LALPHHSUSA-N |
| XLogP | 2.91 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |