C21H32N2O5 — CID 11909761
2-O-[(2S)-1-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 4-O-ethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate (PubChem CID 11909761) has the molecular formula C21H32N2O5 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-O-[(2S)-1-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 4-O-ethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | 2-O-[(2S)-1-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 4-O-ethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 11909761 |
| Molecular Formula | C21H32N2O5 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 2-O-[(2S)-1-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 4-O-ethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C(=O)O[C@@H](C)C(=O)N[C@@H]2CCC[C@H](C)[C@@H]2C)c1C |
| InChI | InChI=1S/C21H32N2O5/c1-7-27-20(25)17-13(4)18(22-14(17)5)21(26)28-15(6)19(24)23-16-10-8-9-11(2)12(16)3/h11-12,15-16,22H,7-10H2,1-6H3,(H,23,24)/t11-,12-,15-,16+/m0/s1 |
| InChIKey | BCFRLKHEEMYQPW-GVAFMPQTSA-N |
| XLogP | 3.29 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |