C20H17F3N2O4 — CID 7279016
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] (3R)-5-oxo-1-phenylpyrrolidine-3-carboxylate (PubChem CID 7279016) has the molecular formula C20H17F3N2O4 and a molecular weight of 406.36 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] (3R)-5-oxo-1-phenylpyrrolidine-3-carboxylate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] (3R)-5-oxo-1-phenylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7279016 |
| Molecular Formula | C20H17F3N2O4 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] (3R)-5-oxo-1-phenylpyrrolidine-3-carboxylate |
| SMILES | O=C(COC(=O)[C@@H]1CC(=O)N(c2ccccc2)C1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H17F3N2O4/c21-20(22,23)15-8-4-5-9-16(15)24-17(26)12-29-19(28)13-10-18(27)25(11-13)14-6-2-1-3-7-14/h1-9,13H,10-12H2,(H,24,26)/t13-/m1/s1 |
| InChIKey | IRWDGKHALWAMSE-CYBMUJFWSA-N |
| XLogP | 3.24 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |