C23H25FN2O4 — CID 7729115
[2-(2-fluoroanilino)-2-oxoethyl] (3S)-1-(4-butylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 7729115) has the molecular formula C23H25FN2O4 and a molecular weight of 412.46 g/mol. Its IUPAC name is [2-(2-fluoroanilino)-2-oxoethyl] (3S)-1-(4-butylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(2-fluoroanilino)-2-oxoethyl] (3S)-1-(4-butylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7729115 |
| Molecular Formula | C23H25FN2O4 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | [2-(2-fluoroanilino)-2-oxoethyl] (3S)-1-(4-butylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCCCc1ccc(N2C[C@@H](C(=O)OCC(=O)Nc3ccccc3F)CC2=O)cc1 |
| InChI | InChI=1S/C23H25FN2O4/c1-2-3-6-16-9-11-18(12-10-16)26-14-17(13-22(26)28)23(29)30-15-21(27)25-20-8-5-4-7-19(20)24/h4-5,7-12,17H,2-3,6,13-15H2,1H3,(H,25,27)/t17-/m0/s1 |
| InChIKey | QPFNPDNHEHBIRF-KRWDZBQOSA-N |
| XLogP | 3.70 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |