C22H24ClNO3 — CID 3400881
(2-chlorophenyl)methyl 1-(4-butylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 3400881) has the molecular formula C22H24ClNO3 and a molecular weight of 385.89 g/mol. Its IUPAC name is (2-chlorophenyl)methyl 1-(4-butylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (2-chlorophenyl)methyl 1-(4-butylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 3400881 |
| Molecular Formula | C22H24ClNO3 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | (2-chlorophenyl)methyl 1-(4-butylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCCCc1ccc(N2CC(C(=O)OCc3ccccc3Cl)CC2=O)cc1 |
| InChI | InChI=1S/C22H24ClNO3/c1-2-3-6-16-9-11-19(12-10-16)24-14-18(13-21(24)25)22(26)27-15-17-7-4-5-8-20(17)23/h4-5,7-12,18H,2-3,6,13-15H2,1H3 |
| InChIKey | NKNIEMHAUCVHAF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |