C23H28N2O5S — CID 46669757
(2-methylphenyl)methyl 1-[4-(diethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxylate (PubChem CID 46669757) has the molecular formula C23H28N2O5S and a molecular weight of 444.55 g/mol. Its IUPAC name is (2-methylphenyl)methyl 1-[4-(diethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (2-methylphenyl)methyl 1-[4-(diethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 46669757 |
| Molecular Formula | C23H28N2O5S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | (2-methylphenyl)methyl 1-[4-(diethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CC(C(=O)OCc3ccccc3C)CC2=O)cc1 |
| InChI | InChI=1S/C23H28N2O5S/c1-4-24(5-2)31(28,29)21-12-10-20(11-13-21)25-15-19(14-22(25)26)23(27)30-16-18-9-7-6-8-17(18)3/h6-13,19H,4-5,14-16H2,1-3H3 |
| InChIKey | LQWWIOOLZXZHOB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |