C8H12O — CID 72793132
(1S,5R)-2-ethenyl-5-methylcyclopent-2-en-1-ol (PubChem CID 72793132) has the molecular formula C8H12O and a molecular weight of 124.18 g/mol. Its IUPAC name is (1S,5R)-2-ethenyl-5-methylcyclopent-2-en-1-ol.
| Compound Name | (1S,5R)-2-ethenyl-5-methylcyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 72793132 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | (1S,5R)-2-ethenyl-5-methylcyclopent-2-en-1-ol |
| SMILES | C=CC1=CC[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C8H12O/c1-3-7-5-4-6(2)8(7)9/h3,5-6,8-9H,1,4H2,2H3/t6-,8+/m1/s1 |
| InChIKey | QTUSJWSQZDDFLY-SVRRBLITSA-N |
| XLogP | 1.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |