C32H50O5 — CID 72793710
2-hydroxyethyl (1S,2S,5R,6R,7R,10S,13R,14R,17R,19R)-19-hydroxy-13,14,18,18-tetramethyl-7-prop-1-en-2-yl-20-oxahexacyclo[17.2.2.01,17.02,14.05,13.06,10]tricosane-10-carboxylate (PubChem CID 72793710) has the molecular formula C32H50O5 and a molecular weight of 514.75 g/mol. Its IUPAC name is 2-hydroxyethyl (1S,2S,5R,6R,7R,10S,13R,14R,17R,19R)-19-hydroxy-13,14,18,18-tetramethyl-7-prop-1-en-2-yl-20-oxahexacyclo[17.2.2.01,17.02,14.05,13.06,10]tricosane-10-carboxylate.
| Compound Name | 2-hydroxyethyl (1S,2S,5R,6R,7R,10S,13R,14R,17R,19R)-19-hydroxy-13,14,18,18-tetramethyl-7-prop-1-en-2-yl-20-oxahexacyclo[17.2.2.01,17.02,14.05,13.06,10]tricosane-10-carboxylate |
|---|---|
| PubChem CID | 72793710 |
| Molecular Formula | C32H50O5 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.37 |
| IUPAC Name | 2-hydroxyethyl (1S,2S,5R,6R,7R,10S,13R,14R,17R,19R)-19-hydroxy-13,14,18,18-tetramethyl-7-prop-1-en-2-yl-20-oxahexacyclo[17.2.2.01,17.02,14.05,13.06,10]tricosane-10-carboxylate |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C(=O)OCCO)CC[C@]3(C)[C@H](CC[C@@H]4[C@]56CC[C@@](O)(OC5)C(C)(C)[C@@H]6CC[C@]43C)[C@@H]12 |
| InChI | InChI=1S/C32H50O5/c1-20(2)21-9-12-30(26(34)36-18-17-33)14-13-28(5)22(25(21)30)7-8-24-29(28,6)11-10-23-27(3,4)32(35)16-15-31(23,24)19-37-32/h21-25,33,35H,1,7-19H2,2-6H3/t21-,22+,23-,24-,25+,28+,29+,30-,31+,32+/m0/s1 |
| InChIKey | BNODUVAGZFJBJW-KUBMXQCBSA-N |
| XLogP | 5.88 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|