C37H52O4 — CID 76685140
benzyl (1S,7R,13R,14R,19R)-19-hydroxy-13,14,18,18-tetramethyl-7-prop-1-en-2-yl-20-oxahexacyclo[17.2.2.01,17.02,14.05,13.06,10]tricosane-10-carboxylate (PubChem CID 76685140) has the molecular formula C37H52O4 and a molecular weight of 560.82 g/mol. Its IUPAC name is benzyl (1S,7R,13R,14R,19R)-19-hydroxy-13,14,18,18-tetramethyl-7-prop-1-en-2-yl-20-oxahexacyclo[17.2.2.01,17.02,14.05,13.06,10]tricosane-10-carboxylate.
| Compound Name | benzyl (1S,7R,13R,14R,19R)-19-hydroxy-13,14,18,18-tetramethyl-7-prop-1-en-2-yl-20-oxahexacyclo[17.2.2.01,17.02,14.05,13.06,10]tricosane-10-carboxylate |
|---|---|
| PubChem CID | 76685140 |
| Molecular Formula | C37H52O4 |
| Molecular Weight | 560.82 g/mol |
| Exact Mass | 560.39 |
| IUPAC Name | benzyl (1S,7R,13R,14R,19R)-19-hydroxy-13,14,18,18-tetramethyl-7-prop-1-en-2-yl-20-oxahexacyclo[17.2.2.01,17.02,14.05,13.06,10]tricosane-10-carboxylate |
| SMILES | C=C(C)C1CCC2(C(=O)OCc3ccccc3)CC[C@]3(C)C(CCC4[C@]56CC[C@@](O)(OC5)C(C)(C)C6CC[C@]43C)C12 |
| InChI | InChI=1S/C37H52O4/c1-24(2)26-14-17-35(31(38)40-22-25-10-8-7-9-11-25)19-18-33(5)27(30(26)35)12-13-29-34(33,6)16-15-28-32(3,4)37(39)21-20-36(28,29)23-41-37/h7-11,26-30,39H,1,12-23H2,2-6H3/t26?,27?,28?,29?,30?,33-,34-,35?,36-,37-/m1/s1 |
| InChIKey | ZKNGGIKCLYOQQA-KERHMNDBSA-N |
| XLogP | 8.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.82 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|