C21H26FN3O5S2 — CID 72803456
[[3-[[2-(4-fluorophenyl)-2-hydroxyethyl]-methylsulfamoyl]-5,6-dihydro-4H-1-benzothiophen-7-ylidene]amino] N-propan-2-ylcarbamate (PubChem CID 72803456) has the molecular formula C21H26FN3O5S2 and a molecular weight of 483.59 g/mol. Its IUPAC name is [[3-[[2-(4-fluorophenyl)-2-hydroxyethyl]-methylsulfamoyl]-5,6-dihydro-4H-1-benzothiophen-7-ylidene]amino] N-propan-2-ylcarbamate.
| Compound Name | [[3-[[2-(4-fluorophenyl)-2-hydroxyethyl]-methylsulfamoyl]-5,6-dihydro-4H-1-benzothiophen-7-ylidene]amino] N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 72803456 |
| Molecular Formula | C21H26FN3O5S2 |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | [[3-[[2-(4-fluorophenyl)-2-hydroxyethyl]-methylsulfamoyl]-5,6-dihydro-4H-1-benzothiophen-7-ylidene]amino] N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)ON=C1CCCc2c(S(=O)(=O)N(C)CC(O)c3ccc(F)cc3)csc21 |
| InChI | InChI=1S/C21H26FN3O5S2/c1-13(2)23-21(27)30-24-17-6-4-5-16-19(12-31-20(16)17)32(28,29)25(3)11-18(26)14-7-9-15(22)10-8-14/h7-10,12-13,18,26H,4-6,11H2,1-3H3,(H,23,27) |
| InChIKey | RNBSLQQBQKUZHJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|