C25H26FN3O6S2 — CID 21098688
[(Z)-[3-[[2-(4-fluorophenyl)-2-hydroxyethyl]-methylsulfamoyl]-5,6-dihydro-4H-1-benzothiophen-7-ylidene]amino] N-(2-methoxyphenyl)carbamate (PubChem CID 21098688) has the molecular formula C25H26FN3O6S2 and a molecular weight of 547.63 g/mol. Its IUPAC name is [(Z)-[3-[[2-(4-fluorophenyl)-2-hydroxyethyl]-methylsulfamoyl]-5,6-dihydro-4H-1-benzothiophen-7-ylidene]amino] N-(2-methoxyphenyl)carbamate.
| Compound Name | [(Z)-[3-[[2-(4-fluorophenyl)-2-hydroxyethyl]-methylsulfamoyl]-5,6-dihydro-4H-1-benzothiophen-7-ylidene]amino] N-(2-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 21098688 |
| Molecular Formula | C25H26FN3O6S2 |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | [(Z)-[3-[[2-(4-fluorophenyl)-2-hydroxyethyl]-methylsulfamoyl]-5,6-dihydro-4H-1-benzothiophen-7-ylidene]amino] N-(2-methoxyphenyl)carbamate |
| SMILES | COc1ccccc1NC(=O)O/N=C1/CCCc2c(S(=O)(=O)N(C)CC(O)c3ccc(F)cc3)csc21 |
| InChI | InChI=1S/C25H26FN3O6S2/c1-29(14-21(30)16-10-12-17(26)13-11-16)37(32,33)23-15-36-24-18(23)6-5-8-20(24)28-35-25(31)27-19-7-3-4-9-22(19)34-2/h3-4,7,9-13,15,21,30H,5-6,8,14H2,1-2H3,(H,27,31)/b28-20- |
| InChIKey | QUWQTFREFWYAQQ-RRAHZORUSA-N |
| XLogP | 4.54 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|