C11H11N5O2S — CID 728063
N-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzamide (PubChem CID 728063) has the molecular formula C11H11N5O2S and a molecular weight of 277.31 g/mol. Its IUPAC name is N-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzamide.
| Compound Name | N-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzamide |
|---|---|
| PubChem CID | 728063 |
| Molecular Formula | C11H11N5O2S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | N-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzamide |
| SMILES | Nc1nc(SCC(=O)NC(=O)c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C11H11N5O2S/c12-10-14-11(16-15-10)19-6-8(17)13-9(18)7-4-2-1-3-5-7/h1-5H,6H2,(H,13,17,18)(H3,12,14,15,16) |
| InChIKey | QYLHMSQYEVTJRU-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |