C12H16N6OS — CID 3630417
2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N-[4-(dimethylamino)phenyl]acetamide (PubChem CID 3630417) has the molecular formula C12H16N6OS and a molecular weight of 292.37 g/mol. Its IUPAC name is 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 3630417 |
| Molecular Formula | C12H16N6OS |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N-[4-(dimethylamino)phenyl]acetamide |
| SMILES | CN(C)c1ccc(NC(=O)CSc2n[nH]c(N)n2)cc1 |
| InChI | InChI=1S/C12H16N6OS/c1-18(2)9-5-3-8(4-6-9)14-10(19)7-20-12-15-11(13)16-17-12/h3-6H,7H2,1-2H3,(H,14,19)(H3,13,15,16,17) |
| InChIKey | MBBSTRKVQWPJGQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|