C18H18FN5OS — CID 7649733
N-[4-(dimethylamino)phenyl]-2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 7649733) has the molecular formula C18H18FN5OS and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 7649733 |
| Molecular Formula | C18H18FN5OS |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CN(C)c1ccc(NC(=O)CSc2n[nH]c(-c3ccccc3F)n2)cc1 |
| InChI | InChI=1S/C18H18FN5OS/c1-24(2)13-9-7-12(8-10-13)20-16(25)11-26-18-21-17(22-23-18)14-5-3-4-6-15(14)19/h3-10H,11H2,1-2H3,(H,20,25)(H,21,22,23) |
| InChIKey | MMYQZVVOPDEMDD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|