C20H25N3O3S — CID 7281543
(5R)-5-(2,3-dimethoxyphenyl)-11-propan-2-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one (PubChem CID 7281543) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is (5R)-5-(2,3-dimethoxyphenyl)-11-propan-2-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one.
| Compound Name | (5R)-5-(2,3-dimethoxyphenyl)-11-propan-2-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
|---|---|
| PubChem CID | 7281543 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | (5R)-5-(2,3-dimethoxyphenyl)-11-propan-2-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
| SMILES | COc1cccc([C@@H]2NC(=O)c3c(sc4c3CCN(C(C)C)C4)N2)c1OC |
| InChI | InChI=1S/C20H25N3O3S/c1-11(2)23-9-8-12-15(10-23)27-20-16(12)19(24)21-18(22-20)13-6-5-7-14(25-3)17(13)26-4/h5-7,11,18,22H,8-10H2,1-4H3,(H,21,24)/t18-/m1/s1 |
| InChIKey | PUSRXARGBCSOPN-GOSISDBHSA-N |
| XLogP | 3.39 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |