C25H36O6 — CID 72817143
16-(3-carboxy-2-methylprop-2-enoyl)oxy-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraenoic acid (PubChem CID 72817143) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is 16-(3-carboxy-2-methylprop-2-enoyl)oxy-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraenoic acid.
| Compound Name | 16-(3-carboxy-2-methylprop-2-enoyl)oxy-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraenoic acid |
|---|---|
| PubChem CID | 72817143 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 16-(3-carboxy-2-methylprop-2-enoyl)oxy-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraenoic acid |
| SMILES | CC(=CCCC(C)=CCOC(=O)C(C)=CC(=O)O)CCC=C(C)CCC=C(C)C(=O)O |
| InChI | InChI=1S/C25H36O6/c1-18(9-6-10-19(2)13-8-14-21(4)24(28)29)11-7-12-20(3)15-16-31-25(30)22(5)17-23(26)27/h10-11,14-15,17H,6-9,12-13,16H2,1-5H3,(H,26,27)(H,28,29) |
| InChIKey | RGDGFPUBWJTQHJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|