C14H15BrO2 — CID 72833829
1-bromo-9-(furan-2-yl)tricyclo[4.2.1.12,5]dec-3-en-9-ol (PubChem CID 72833829) has the molecular formula C14H15BrO2 and a molecular weight of 295.18 g/mol. Its IUPAC name is 1-bromo-9-(furan-2-yl)tricyclo[4.2.1.12,5]dec-3-en-9-ol.
| Compound Name | 1-bromo-9-(furan-2-yl)tricyclo[4.2.1.12,5]dec-3-en-9-ol |
|---|---|
| PubChem CID | 72833829 |
| Molecular Formula | C14H15BrO2 |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 1-bromo-9-(furan-2-yl)tricyclo[4.2.1.12,5]dec-3-en-9-ol |
| SMILES | OC1(c2ccco2)C2CCC1(Br)C1C=CC2C1 |
| InChI | InChI=1S/C14H15BrO2/c15-13-6-5-11(9-3-4-10(13)8-9)14(13,16)12-2-1-7-17-12/h1-4,7,9-11,16H,5-6,8H2 |
| InChIKey | HMTVXOGDHDATFO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|