C26H35NO — CID 7283492
(6R)-2-[(E)-2-(4-butoxyphenyl)ethenyl]-6-pentyl-5,6,7,8-tetrahydroquinoline (PubChem CID 7283492) has the molecular formula C26H35NO and a molecular weight of 377.57 g/mol. Its IUPAC name is (6R)-2-[(E)-2-(4-butoxyphenyl)ethenyl]-6-pentyl-5,6,7,8-tetrahydroquinoline.
| Compound Name | (6R)-2-[(E)-2-(4-butoxyphenyl)ethenyl]-6-pentyl-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 7283492 |
| Molecular Formula | C26H35NO |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | (6R)-2-[(E)-2-(4-butoxyphenyl)ethenyl]-6-pentyl-5,6,7,8-tetrahydroquinoline |
| SMILES | CCCCC[C@@H]1CCc2nc(/C=C/c3ccc(OCCCC)cc3)ccc2C1 |
| InChI | InChI=1S/C26H35NO/c1-3-5-7-8-22-12-18-26-23(20-22)13-15-24(27-26)14-9-21-10-16-25(17-11-21)28-19-6-4-2/h9-11,13-17,22H,3-8,12,18-20H2,1-2H3/b14-9+/t22-/m1/s1 |
| InChIKey | GBGGYUKAQKGFKV-UBLKFNIESA-N |
| XLogP | 7.12 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|