C20H32N2 — CID 175066876
3-(6-hexyl-5,6,7,8-tetrahydroquinolin-2-yl)cyclopentan-1-amine (PubChem CID 175066876) has the molecular formula C20H32N2 and a molecular weight of 300.49 g/mol. Its IUPAC name is 3-(6-hexyl-5,6,7,8-tetrahydroquinolin-2-yl)cyclopentan-1-amine.
| Compound Name | 3-(6-hexyl-5,6,7,8-tetrahydroquinolin-2-yl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 175066876 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | 3-(6-hexyl-5,6,7,8-tetrahydroquinolin-2-yl)cyclopentan-1-amine |
| SMILES | CCCCCCC1CCc2nc(C3CCC(N)C3)ccc2C1 |
| InChI | InChI=1S/C20H32N2/c1-2-3-4-5-6-15-7-11-19-16(13-15)9-12-20(22-19)17-8-10-18(21)14-17/h9,12,15,17-18H,2-8,10-11,13-14,21H2,1H3 |
| InChIKey | LNNYVEVTXURQRL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|