C9H13N3O3 — CID 728363
N-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2-dimethylpropanamide (PubChem CID 728363) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is N-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2-dimethylpropanamide.
| Compound Name | N-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 728363 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | N-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H13N3O3/c1-9(2,3)7(14)11-5-4-10-8(15)12-6(5)13/h4H,1-3H3,(H,11,14)(H2,10,12,13,15) |
| InChIKey | KWARPIRDJMRWSH-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |