C20H27FN4O — CID 72839193
2-(dimethylamino)-2-(4-fluorophenyl)-1-[4-(2-pyrrol-1-ylethyl)piperazin-1-yl]ethanone (PubChem CID 72839193) has the molecular formula C20H27FN4O and a molecular weight of 358.46 g/mol. Its IUPAC name is 2-(dimethylamino)-2-(4-fluorophenyl)-1-[4-(2-pyrrol-1-ylethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(dimethylamino)-2-(4-fluorophenyl)-1-[4-(2-pyrrol-1-ylethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 72839193 |
| Molecular Formula | C20H27FN4O |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 2-(dimethylamino)-2-(4-fluorophenyl)-1-[4-(2-pyrrol-1-ylethyl)piperazin-1-yl]ethanone |
| SMILES | CN(C)C(C(=O)N1CCN(CCn2cccc2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H27FN4O/c1-22(2)19(17-5-7-18(21)8-6-17)20(26)25-15-13-24(14-16-25)12-11-23-9-3-4-10-23/h3-10,19H,11-16H2,1-2H3 |
| InChIKey | RJLJZOGIVVLGDG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 31.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |