C21H34N4O — CID 72931057
2-(dimethylamino)-2-(2-methylphenyl)-1-[4-(2-pyrrolidin-1-ylethyl)piperazin-1-yl]ethanone (PubChem CID 72931057) has the molecular formula C21H34N4O and a molecular weight of 358.53 g/mol. Its IUPAC name is 2-(dimethylamino)-2-(2-methylphenyl)-1-[4-(2-pyrrolidin-1-ylethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(dimethylamino)-2-(2-methylphenyl)-1-[4-(2-pyrrolidin-1-ylethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 72931057 |
| Molecular Formula | C21H34N4O |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | 2-(dimethylamino)-2-(2-methylphenyl)-1-[4-(2-pyrrolidin-1-ylethyl)piperazin-1-yl]ethanone |
| SMILES | Cc1ccccc1C(C(=O)N1CCN(CCN2CCCC2)CC1)N(C)C |
| InChI | InChI=1S/C21H34N4O/c1-18-8-4-5-9-19(18)20(22(2)3)21(26)25-16-14-24(15-17-25)13-12-23-10-6-7-11-23/h4-5,8-9,20H,6-7,10-17H2,1-3H3 |
| InChIKey | ZMSWLSKZYGFQRN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |