C20H31N3OS — CID 97192752
(2R)-2-(dimethylamino)-2-(2-methylphenyl)-1-(4-thiomorpholin-4-ylpiperidin-1-yl)ethanone (PubChem CID 97192752) has the molecular formula C20H31N3OS and a molecular weight of 361.56 g/mol. Its IUPAC name is (2R)-2-(dimethylamino)-2-(2-methylphenyl)-1-(4-thiomorpholin-4-ylpiperidin-1-yl)ethanone.
| Compound Name | (2R)-2-(dimethylamino)-2-(2-methylphenyl)-1-(4-thiomorpholin-4-ylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 97192752 |
| Molecular Formula | C20H31N3OS |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | (2R)-2-(dimethylamino)-2-(2-methylphenyl)-1-(4-thiomorpholin-4-ylpiperidin-1-yl)ethanone |
| SMILES | Cc1ccccc1[C@H](C(=O)N1CCC(N2CCSCC2)CC1)N(C)C |
| InChI | InChI=1S/C20H31N3OS/c1-16-6-4-5-7-18(16)19(21(2)3)20(24)23-10-8-17(9-11-23)22-12-14-25-15-13-22/h4-7,17,19H,8-15H2,1-3H3/t19-/m1/s1 |
| InChIKey | FPEMZMXZSMCRIA-LJQANCHMSA-N |
| XLogP | 2.64 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |