C19H28FN3OS — CID 97206351
(2S)-2-(dimethylamino)-2-(2-fluorophenyl)-1-(4-thiomorpholin-4-ylpiperidin-1-yl)ethanone (PubChem CID 97206351) has the molecular formula C19H28FN3OS and a molecular weight of 365.52 g/mol. Its IUPAC name is (2S)-2-(dimethylamino)-2-(2-fluorophenyl)-1-(4-thiomorpholin-4-ylpiperidin-1-yl)ethanone.
| Compound Name | (2S)-2-(dimethylamino)-2-(2-fluorophenyl)-1-(4-thiomorpholin-4-ylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 97206351 |
| Molecular Formula | C19H28FN3OS |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | (2S)-2-(dimethylamino)-2-(2-fluorophenyl)-1-(4-thiomorpholin-4-ylpiperidin-1-yl)ethanone |
| SMILES | CN(C)[C@H](C(=O)N1CCC(N2CCSCC2)CC1)c1ccccc1F |
| InChI | InChI=1S/C19H28FN3OS/c1-21(2)18(16-5-3-4-6-17(16)20)19(24)23-9-7-15(8-10-23)22-11-13-25-14-12-22/h3-6,15,18H,7-14H2,1-2H3/t18-/m0/s1 |
| InChIKey | WZFJBMFJAUMJBI-SFHVURJKSA-N |
| XLogP | 2.47 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |