C20H29N3O3S — CID 72841392
2-[(4aR,7aS)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-N-benzylacetamide (PubChem CID 72841392) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is 2-[(4aR,7aS)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-N-benzylacetamide.
| Compound Name | 2-[(4aR,7aS)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-N-benzylacetamide |
|---|---|
| PubChem CID | 72841392 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-[(4aR,7aS)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-N-benzylacetamide |
| SMILES | CC(C)=CCN1CCN(CC(=O)NCc2ccccc2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C20H29N3O3S/c1-16(2)8-9-22-10-11-23(19-15-27(25,26)14-18(19)22)13-20(24)21-12-17-6-4-3-5-7-17/h3-8,18-19H,9-15H2,1-2H3,(H,21,24)/t18-,19+/m1/s1 |
| InChIKey | BDSUFSHTNNFXRM-MOPGFXCFSA-N |
| XLogP | 1.05 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|