C19H29N3O2S — CID 133118863
(4aR,7aS)-4-(3-methylbut-2-enyl)-1-[2-(6-methyl-2-pyridinyl)ethyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 133118863) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is (4aR,7aS)-4-(3-methylbut-2-enyl)-1-[2-(6-methyl-2-pyridinyl)ethyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-4-(3-methylbut-2-enyl)-1-[2-(6-methyl-2-pyridinyl)ethyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 133118863 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | (4aR,7aS)-4-(3-methylbut-2-enyl)-1-[2-(6-methyl-2-pyridinyl)ethyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | CC(C)=CCN1CCN(CCc2cccc(C)n2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C19H29N3O2S/c1-15(2)7-9-21-11-12-22(19-14-25(23,24)13-18(19)21)10-8-17-6-4-5-16(3)20-17/h4-7,18-19H,8-14H2,1-3H3/t18-,19+/m0/s1 |
| InChIKey | RNSSWLLQUZSAAH-RBUKOAKNSA-N |
| XLogP | 1.68 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|