C9H8F3N5S — CID 72841838
N-[(4-methylthiadiazol-5-yl)methyl]-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 72841838) has the molecular formula C9H8F3N5S and a molecular weight of 275.26 g/mol. Its IUPAC name is N-[(4-methylthiadiazol-5-yl)methyl]-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[(4-methylthiadiazol-5-yl)methyl]-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 72841838 |
| Molecular Formula | C9H8F3N5S |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | N-[(4-methylthiadiazol-5-yl)methyl]-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Cc1nnsc1CNc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H8F3N5S/c1-5-6(18-17-16-5)4-14-8-13-3-2-7(15-8)9(10,11)12/h2-3H,4H2,1H3,(H,13,14,15) |
| InChIKey | ALZFFBYVOBZAFK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |