C21H20N4O2 — CID 72850472
(2-anilinopyrimidin-5-yl)-[2-(3-methoxyphenyl)azetidin-1-yl]methanone (PubChem CID 72850472) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is (2-anilinopyrimidin-5-yl)-[2-(3-methoxyphenyl)azetidin-1-yl]methanone.
| Compound Name | (2-anilinopyrimidin-5-yl)-[2-(3-methoxyphenyl)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 72850472 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (2-anilinopyrimidin-5-yl)-[2-(3-methoxyphenyl)azetidin-1-yl]methanone |
| SMILES | COc1cccc(C2CCN2C(=O)c2cnc(Nc3ccccc3)nc2)c1 |
| InChI | InChI=1S/C21H20N4O2/c1-27-18-9-5-6-15(12-18)19-10-11-25(19)20(26)16-13-22-21(23-14-16)24-17-7-3-2-4-8-17/h2-9,12-14,19H,10-11H2,1H3,(H,22,23,24) |
| InChIKey | ATILXQXPRPYQSU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |