C18H20N2O3 — CID 74235529
[6-(methoxymethyl)-2-pyridinyl]-[2-(3-methoxyphenyl)azetidin-1-yl]methanone (PubChem CID 74235529) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is [6-(methoxymethyl)-2-pyridinyl]-[2-(3-methoxyphenyl)azetidin-1-yl]methanone.
| Compound Name | [6-(methoxymethyl)-2-pyridinyl]-[2-(3-methoxyphenyl)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 74235529 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | [6-(methoxymethyl)-2-pyridinyl]-[2-(3-methoxyphenyl)azetidin-1-yl]methanone |
| SMILES | COCc1cccc(C(=O)N2CCC2c2cccc(OC)c2)n1 |
| InChI | InChI=1S/C18H20N2O3/c1-22-12-14-6-4-8-16(19-14)18(21)20-10-9-17(20)13-5-3-7-15(11-13)23-2/h3-8,11,17H,9-10,12H2,1-2H3 |
| InChIKey | YHRDQPCNHFBOPD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |