C19H21ClN4O2 — CID 72852512
1-[2-chloro-5-(pyrrolidine-1-carbonyl)phenyl]-3-(2-pyridin-2-ylethyl)urea (PubChem CID 72852512) has the molecular formula C19H21ClN4O2 and a molecular weight of 372.86 g/mol. Its IUPAC name is 1-[2-chloro-5-(pyrrolidine-1-carbonyl)phenyl]-3-(2-pyridin-2-ylethyl)urea.
| Compound Name | 1-[2-chloro-5-(pyrrolidine-1-carbonyl)phenyl]-3-(2-pyridin-2-ylethyl)urea |
|---|---|
| PubChem CID | 72852512 |
| Molecular Formula | C19H21ClN4O2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 1-[2-chloro-5-(pyrrolidine-1-carbonyl)phenyl]-3-(2-pyridin-2-ylethyl)urea |
| SMILES | O=C(NCCc1ccccn1)Nc1cc(C(=O)N2CCCC2)ccc1Cl |
| InChI | InChI=1S/C19H21ClN4O2/c20-16-7-6-14(18(25)24-11-3-4-12-24)13-17(16)23-19(26)22-10-8-15-5-1-2-9-21-15/h1-2,5-7,9,13H,3-4,8,10-12H2,(H2,22,23,26) |
| InChIKey | DRBCHEXBHGYNGS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |