C21H28N4O2 — CID 72853657
N'-[6,6-dimethyl-1-(2-methylphenyl)-5,7-dihydro-4H-indazol-4-yl]-N-propyloxamide (PubChem CID 72853657) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N'-[6,6-dimethyl-1-(2-methylphenyl)-5,7-dihydro-4H-indazol-4-yl]-N-propyloxamide.
| Compound Name | N'-[6,6-dimethyl-1-(2-methylphenyl)-5,7-dihydro-4H-indazol-4-yl]-N-propyloxamide |
|---|---|
| PubChem CID | 72853657 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | N'-[6,6-dimethyl-1-(2-methylphenyl)-5,7-dihydro-4H-indazol-4-yl]-N-propyloxamide |
| SMILES | CCCNC(=O)C(=O)NC1CC(C)(C)Cc2c1cnn2-c1ccccc1C |
| InChI | InChI=1S/C21H28N4O2/c1-5-10-22-19(26)20(27)24-16-11-21(3,4)12-18-15(16)13-23-25(18)17-9-7-6-8-14(17)2/h6-9,13,16H,5,10-12H2,1-4H3,(H,22,26)(H,24,27) |
| InChIKey | HOJVSKDNNNYSGJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|