C26H26N4O3 — CID 25370066
N-[(4R)-6,6-dimethyl-1-(2-methylphenyl)-5,7-dihydro-4H-indazol-4-yl]-2-(1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 25370066) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is N-[(4R)-6,6-dimethyl-1-(2-methylphenyl)-5,7-dihydro-4H-indazol-4-yl]-2-(1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[(4R)-6,6-dimethyl-1-(2-methylphenyl)-5,7-dihydro-4H-indazol-4-yl]-2-(1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 25370066 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | N-[(4R)-6,6-dimethyl-1-(2-methylphenyl)-5,7-dihydro-4H-indazol-4-yl]-2-(1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | Cc1ccccc1-n1ncc2c1CC(C)(C)C[C@H]2NC(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H26N4O3/c1-16-8-4-7-11-21(16)30-22-13-26(2,3)12-20(19(22)14-27-30)28-23(31)15-29-24(32)17-9-5-6-10-18(17)25(29)33/h4-11,14,20H,12-13,15H2,1-3H3,(H,28,31)/t20-/m1/s1 |
| InChIKey | WEUQRZHAOQBPFG-HXUWFJFHSA-N |
| XLogP | 3.61 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|