C13H14FN3O5S — CID 72854238
2-(2,5-dioxoimidazolidin-1-yl)-N-[2-(4-fluorophenyl)sulfonylethyl]acetamide (PubChem CID 72854238) has the molecular formula C13H14FN3O5S and a molecular weight of 343.34 g/mol. Its IUPAC name is 2-(2,5-dioxoimidazolidin-1-yl)-N-[2-(4-fluorophenyl)sulfonylethyl]acetamide.
| Compound Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-[2-(4-fluorophenyl)sulfonylethyl]acetamide |
|---|---|
| PubChem CID | 72854238 |
| Molecular Formula | C13H14FN3O5S |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-[2-(4-fluorophenyl)sulfonylethyl]acetamide |
| SMILES | O=C(CN1C(=O)CNC1=O)NCCS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H14FN3O5S/c14-9-1-3-10(4-2-9)23(21,22)6-5-15-11(18)8-17-12(19)7-16-13(17)20/h1-4H,5-8H2,(H,15,18)(H,16,20) |
| InChIKey | IFKRKUCQQHWORL-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|