C14H20N2O3S — CID 72854249
(3R,4S)-4-cyclopropyl-1-(3-methoxyphenyl)sulfonylpyrrolidin-3-amine (PubChem CID 72854249) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is (3R,4S)-4-cyclopropyl-1-(3-methoxyphenyl)sulfonylpyrrolidin-3-amine.
| Compound Name | (3R,4S)-4-cyclopropyl-1-(3-methoxyphenyl)sulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 72854249 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (3R,4S)-4-cyclopropyl-1-(3-methoxyphenyl)sulfonylpyrrolidin-3-amine |
| SMILES | COc1cccc(S(=O)(=O)N2C[C@H](C3CC3)[C@@H](N)C2)c1 |
| InChI | InChI=1S/C14H20N2O3S/c1-19-11-3-2-4-12(7-11)20(17,18)16-8-13(10-5-6-10)14(15)9-16/h2-4,7,10,13-14H,5-6,8-9,15H2,1H3/t13-,14+/m1/s1 |
| InChIKey | RWWGFUVGRGWQRE-KGLIPLIRSA-N |
| XLogP | 1.05 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |